114926-37-3 Usage
Description
3-Methylphenyl-L-alanine is an amino acid derivative that plays a significant role in various biological and pharmaceutical applications. It is characterized by the presence of a methyl group attached to the phenyl ring and an L-alanine moiety, which contributes to its unique properties and functions.
Uses
Used in Pharmaceutical Industry:
3-Methylphenyl-L-alanine is used as a key component in the development of N-acyl 4-(5-pyrimidine-2,4-dionyl)phenylalanine derivatives and their orally active prodrug esters. These compounds serve as dual-acting alpha4-beta1 and alpha4-beta7 receptor antagonists, which are crucial in the treatment of various diseases and conditions related to these receptors.
Used in Research and Development:
3-Methylphenyl-L-alanine is also utilized in the identification and characterization of novel compounds with potential therapeutic applications. Its unique structure allows for the development of new drugs and drug candidates that can target specific receptors and pathways, leading to improved treatment options for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 114926-37-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,4,9,2 and 6 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 114926-37:
(8*1)+(7*1)+(6*4)+(5*9)+(4*2)+(3*6)+(2*3)+(1*7)=123
123 % 10 = 3
So 114926-37-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO2/c1-7-3-2-4-8(5-7)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m1/s1
