116-77-8 Usage
Description
1-amino-2-methyl-4-[(4-methylphenyl)amino]anthraquinone is an organic compound characterized by its red light blue color. It exhibits unique properties when exposed to concentrated sulfuric acid, turning purple and forming a purple precipitate upon release.
Uses
Used in Dye Industry:
1-amino-2-methyl-4-[(4-methylphenyl)amino]anthraquinone is used as a dye for its distinctive red light blue color. Its color-changing properties in the presence of concentrated sulfuric acid make it a versatile compound for various dye applications.
Used in Chemical Research:
1-amino-2-methyl-4-[(4-methylphenyl)amino]anthraquinone serves as a valuable compound in chemical research, particularly in the study of anthraquinone derivatives and their interactions with acids. Its unique properties provide insights into the behavior of similar compounds and contribute to the development of new chemical processes and applications.
Preparation
1-Amino-4-bromo-2-methylanthracene-9,10-dione or 1-Amino-4-chloro-2-methylanthracene-9,10-dione?and p-Methylaniline condensation.
Check Digit Verification of cas no
The CAS Registry Mumber 116-77-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,1 and 6 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 116-77:
(5*1)+(4*1)+(3*6)+(2*7)+(1*7)=48
48 % 10 = 8
So 116-77-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H18N2O2/c1-12-7-9-14(10-8-12)24-17-11-13(2)20(23)19-18(17)21(25)15-5-3-4-6-16(15)22(19)26/h3-11,24H,23H2,1-2H3