116081-20-0 Usage
Molecular structure
A complex structure containing a pyrazolo and pyridinone ring system.
Heterocyclic compound
Consists of a ring structure with both carbon and non-carbon atoms.
Hydroxy group
Contains an -OH functional group attached to the pyrazole ring.
Methyl group
Contains a -CH3 functional group attached to the pyrazole ring.
Physical state
A yellow solid at room temperature.
Solubility
Soluble in organic solvents, such as ethanol, methanol, and acetone.
Research applications
Utilized in scientific research for studying its properties and potential uses.
Pharmaceutical applications
Explored for its potential therapeutic properties in the development of new drugs.
Building block
Can be used as a starting point for the synthesis of more complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 116081-20-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,0,8 and 1 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 116081-20:
(8*1)+(7*1)+(6*6)+(5*0)+(4*8)+(3*1)+(2*2)+(1*0)=90
90 % 10 = 0
So 116081-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3O2/c1-3-2-4(11)5-6(8-3)9-10-7(5)12/h2H,1H3,(H3,8,9,10,11,12)
