116903-48-1 Usage
General Description
1-[(4-Ethoxyphenyl)ethinyl]-4-(4-trans-propylcyclohexyl)-benzol is a chemical compound with a complex structure consisting of an ethoxyphenyl group attached to an ethynyl group and a propylcyclohexyl group attached to a benzene ring. The compound has potential applications in the pharmaceutical and material science industries due to its unique structural features. It may possess interesting pharmacological properties, and its aromatic nature could make it useful for the development of new organic electronic materials. Additionally, its specific arrangement of functional groups may contribute to its potential for biological activity, making it a target for further study and development.
Check Digit Verification of cas no
The CAS Registry Mumber 116903-48-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,9,0 and 3 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 116903-48:
(8*1)+(7*1)+(6*6)+(5*9)+(4*0)+(3*3)+(2*4)+(1*8)=121
121 % 10 = 1
So 116903-48-1 is a valid CAS Registry Number.
InChI:InChI=1/C25H30O/c1-3-5-20-8-14-23(15-9-20)24-16-10-21(11-17-24)6-7-22-12-18-25(19-13-22)26-4-2/h10-13,16-20,23H,3-5,8-9,14-15H2,1-2H3/t20-,23-