116965-13-0 Usage
General Description
3-(4-Methylphenoxy)-1,2-benzenedicarbonitrile is a chemical compound with the molecular formula C15H10N2O. It is a white solid with a molecular weight of 234.25 g/mol. 3-(4-METHYLPHENOXY)-1,2-BENZENEDICARBONITRILE has potential applications in the field of organic synthesis and pharmaceuticals, due to its unique chemical structure and properties. It is commonly used as a building block for the synthesis of various organic compounds, and it has been studied for its potential biological activities. However, more research is needed to fully understand its potential applications and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 116965-13-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,9,6 and 5 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 116965-13:
(8*1)+(7*1)+(6*6)+(5*9)+(4*6)+(3*5)+(2*1)+(1*3)=140
140 % 10 = 0
So 116965-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H10N2O/c1-11-5-7-13(8-6-11)18-15-4-2-3-12(9-16)14(15)10-17/h2-8H,1H3
