117007-51-9 Usage
Description
3-Chloro-1H-pyrazolo[3,4-b]pyridine is an organic compound characterized by its white solid appearance. It is a heterocyclic compound with a unique chemical structure that features a pyrazolo and pyridine ring fused together, with a chlorine atom attached at the 3rd position. 3-CHLORO-1H-PYRAZOLO[3,4-B]PYRIDINE is known for its potential applications in the pharmaceutical industry, particularly in the development of novel therapeutic agents.
Uses
Used in Pharmaceutical Industry:
3-Chloro-1H-pyrazolo[3,4-b]pyridine is used as a key intermediate in the synthesis of azaindazole compounds, which are known as CCR1 antagonists. These antagonists play a crucial role in modulating the immune response and have potential applications in the treatment of various inflammatory and autoimmune diseases, such as asthma, rheumatoid arthritis, and multiple sclerosis.
Used in Chemical Research:
As a heterocyclic compound with a distinct chemical structure, 3-chloro-1H-pyrazolo[3,4-b]pyridine can also be utilized in chemical research for the development of new compounds with potential applications in various fields, including pharmaceuticals, materials science, and agrochemicals. Its unique structure allows for further functionalization and modification, enabling the exploration of new chemical reactions and the synthesis of novel molecules with desired properties.
Check Digit Verification of cas no
The CAS Registry Mumber 117007-51-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,7,0,0 and 7 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 117007-51:
(8*1)+(7*1)+(6*7)+(5*0)+(4*0)+(3*7)+(2*5)+(1*1)=89
89 % 10 = 9
So 117007-51-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClN3/c7-5-4-2-1-3-8-6(4)10-9-5/h1-3H,(H,8,9,10)