117970-23-7 Usage
Description
6-Chloro-4-methoxyindole is a chemical compound derived from fava beans, characterized by its beige crystalline solid appearance. It possesses unique chemical properties that make it a promutagen, which means it has the potential to induce genetic mutations.
Uses
Used in Chemical Research:
6-Chloro-4-methoxyindole is used as a research compound in various scientific studies, particularly in the field of genetics and molecular biology. Its promutagenic properties allow researchers to investigate the mechanisms of genetic mutations and their effects on cellular processes.
Used in Pharmaceutical Development:
Due to its potential mutagenic activity, 6-Chloro-4-methoxyindole can be utilized in the development of pharmaceuticals targeting specific genetic disorders or diseases. Its ability to induce mutations can be harnessed to create novel therapeutic agents that modulate gene expression or alter cellular functions.
Used in Agrochemical Industry:
In the agrochemical industry, 6-Chloro-4-methoxyindole can be employed as a tool to study the effects of genetic mutations on plant growth and development. This knowledge can be applied to develop new strategies for crop improvement and resistance to various environmental stressors.
Check Digit Verification of cas no
The CAS Registry Mumber 117970-23-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,7,9,7 and 0 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 117970-23:
(8*1)+(7*1)+(6*7)+(5*9)+(4*7)+(3*0)+(2*2)+(1*3)=137
137 % 10 = 7
So 117970-23-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8ClNO/c1-12-9-5-6(10)4-8-7(9)2-3-11-8/h2-5,11H,1H3