120208-33-5 Usage
General Description
Thieno[3,2-b]pyridine, 3-amino- (6CI) is a chemical compound with the molecular formula C7H6N2S. It is a derivative of thieno[3,2-b]pyridine, which is a heterocyclic compound containing both sulfur and nitrogen atoms in its ring structure. The 3-amino substitution indicates that an amino group is attached to the third carbon atom of the thieno[3,2-b]pyridine ring. Thieno[3,2-b]pyridine, 3-amino- (6CI) has potential applications in the pharmaceutical industry as a building block for the synthesis of various drug molecules. Additionally, its structural features may contribute to its biological activity, making it a valuable target for research in medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 120208-33-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,2,0 and 8 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 120208-33:
(8*1)+(7*2)+(6*0)+(5*2)+(4*0)+(3*8)+(2*3)+(1*3)=65
65 % 10 = 5
So 120208-33-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N2S/c8-5-4-10-6-2-1-3-9-7(5)6/h1-4H,8H2