121477-75-6 Usage
General Description
Ethanol, 2-[(5-methyl-1H-benzimidazol-2-yl)amino]- (9CI) is a chemical compound with the molecular formula C10H13N3O. It is a benzimidazole derivative that is commonly used in pharmaceutical research and drug development. The compound has been studied for its potential biological activity, particularly its role as an inhibitor of certain enzymes involved in various cellular processes. Additionally, it has been investigated for its potential as a therapeutic agent for a range of medical conditions, including cancer and infectious diseases. The compound's unique structure and potential biological activity make it a subject of ongoing scientific interest and investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 121477-75-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,4,7 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 121477-75:
(8*1)+(7*2)+(6*1)+(5*4)+(4*7)+(3*7)+(2*7)+(1*5)=116
116 % 10 = 6
So 121477-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3O/c1-7-2-3-8-9(6-7)13-10(12-8)11-4-5-14/h2-3,6,14H,4-5H2,1H3,(H2,11,12,13)
