12152-94-2 Usage
Description
Ferroceneboronic acid is an organic compound that features a ferrocene group attached to a boronic acid moiety. It is known for its unique chemical properties, which include redox activity and the ability to form stable complexes with sugars. This makes it a versatile molecule with potential applications in various fields.
Uses
Used in Analytical Chemistry:
Ferroceneboronic acid is used as a redox-active electrochemical probe for monitoring interactions involving sugars. Its redox properties and affinity for sugars make it a valuable tool in the study of sugar-related processes and interactions.
Used in Synthetic Chemistry:
1. In the synthesis of ferrocene-appended subporphyrins, ferroceneboronic acid serves as a key reactant for investigating the electrochemical properties of these complexes. This application is particularly relevant in the development of new materials for energy storage and conversion.
2. As a component in the synthesis of catalysts for the polymerization of olefins, ferroceneboronic acid contributes to the development of more efficient and selective catalysts for industrial polymer production.
3. In the Suzuki-coupling reaction, ferroceneboronic acid acts as a reactant, enabling the formation of new carbon-carbon bonds in the synthesis of various organic compounds.
4. Ferroceneboronic acid is also utilized in catalytic ortho-lithiation reactions, where it aids in the selective lithiation of aromatic compounds, facilitating further functionalization and synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 12152-94-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,1,5 and 2 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 12152-94:
(7*1)+(6*2)+(5*1)+(4*5)+(3*2)+(2*9)+(1*4)=72
72 % 10 = 2
So 12152-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H6BO2.C5H5.Fe/c7-6(8)5-3-1-2-4-5;1-2-4-5-3-1;/h1-4,7-8H;1-5H;/q2*-1;+2
12152-94-2Relevant articles and documents
Palladium-catalyzed arylation of ferrocene derivatives: a convenient high yield route to 1,1'-bis(halophenyl)ferrocenes
Knapp, Ralf,Rehahn, Matthias
, p. 235 - 240 (1993)
The Pd-catalyzed cross-coupling reaction between halobenzenes and ferrocene-1,1'-diboronic acid is reported.Condensation proceeds smoothly to give 1,1'-diphenyl- and 1,1'-bis(halophenyl)-substituted ferrocenes bearing fluoro, chloro and bromo substituents in good yields.An effective synthesis of the intermediate ferrocene-1,1'-diboronic acid is described.
