121801-61-4 Usage
General Description
The chemical compound H-PRO-ASP-VAL-ASP-HIS-VAL-PHE-LEU-ARG-PHE-NH2 is a neuropeptide composed of a sequence of amino acids. It possesses a high proline content at the beginning, followed by aspartic acid, valine, histidine, phenylalanine, leucine, and arginine. This neuropeptide may have potential biological and pharmacological activities due to its specific sequence and structure, which can interact with various receptors and enzymes in the body. Additionally, the presence of the C-terminal amide group indicates its stability and potential for prolonged activity in the body. Further research is needed to determine the specific biological effects and potential applications of this neuropeptide.
Check Digit Verification of cas no
The CAS Registry Mumber 121801-61-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,8,0 and 1 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 121801-61:
(8*1)+(7*2)+(6*1)+(5*8)+(4*0)+(3*1)+(2*6)+(1*1)=84
84 % 10 = 4
So 121801-61-4 is a valid CAS Registry Number.
InChI:InChI=1/C59H86N16O14/c1-31(2)23-40(52(83)67-38(20-14-22-65-59(61)62)51(82)68-39(49(60)80)24-34-15-9-7-10-16-34)69-53(84)41(25-35-17-11-8-12-18-35)72-57(88)47(32(3)4)74-55(86)42(26-36-29-63-30-66-36)70-54(85)43(27-45(76)77)73-58(89)48(33(5)6)75-56(87)44(28-46(78)79)71-50(81)37-19-13-21-64-37/h7-12,15-18,29-33,37-44,47-48,64H,13-14,19-28H2,1-6H3,(H2,60,80)(H,63,66)(H,67,83)(H,68,82)(H,69,84)(H,70,85)(H,71,81)(H,72,88)(H,73,89)(H,74,86)(H,75,87)(H,76,77)(H,78,79)(H4,61,62,65)/t37-,38-,39-,40-,41-,42+,43-,44-,47-,48-/m0/s1