128-83-6 Usage
Description
1-amino-2-bromo-4-p-toluidinoanthraquinone is an organic compound characterized by its unique molecular structure, which features an anthraquinone core with a bromine atom at the 2-position, an amino group at the 1-position, and a p-toluidino group at the 4-position. 1-amino-2-bromo-4-p-toluidinoanthraquinone exhibits distinctive chemical and physical properties, such as its color-changing behavior in the presence of concentrated sulfuric acid.
Uses
Used in Chemical Industry:
1-amino-2-bromo-4-p-toluidinoanthraquinone is used as an intermediate in the synthesis of various organic compounds and dyes. Its unique structure allows it to be a versatile building block for the development of new molecules with potential applications in various fields.
Used in Analytical Chemistry:
1-amino-2-bromo-4-p-toluidinoanthraquinone is used as a reagent in analytical chemistry for the detection and quantification of certain substances. Its color-changing properties in the presence of concentrated sulfuric acid make it a useful indicator for titration and other analytical techniques.
Used in Dye Industry:
1-amino-2-bromo-4-p-toluidinoanthraquinone is used as a dye in various applications, such as textiles, plastics, and printing inks. Its distinctive color and chemical properties make it a valuable component in the formulation of dyes with specific characteristics.
Used in Research and Development:
1-amino-2-bromo-4-p-toluidinoanthraquinone is used in research and development for the study of its chemical properties and potential applications. Its unique structure and reactivity make it an interesting subject for scientific investigation and the development of new technologies.
Preparation
1-Amino-2,4-dibromoanthracene-9,10-dione and p-Methylaniline condensation.
Check Digit Verification of cas no
The CAS Registry Mumber 128-83-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,2 and 8 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 128-83:
(5*1)+(4*2)+(3*8)+(2*8)+(1*3)=56
56 % 10 = 6
So 128-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H15BrN2O2/c1-11-6-8-12(9-7-11)24-16-10-15(22)19(23)18-17(16)20(25)13-4-2-3-5-14(13)21(18)26/h2-10,24H,23H2,1H3
128-83-6Relevant articles and documents
PHYSICAL CHARACTERISTICS OF SYNTHESIZED 1-AMINO-4-(ARYLAMINO)ANTHRAQUINONE 2-ETHER DYES FOR SYNTHETIC-POLYMER FIBERS.
Ukponmwan,Greenhalgh,Peters
, p. 482 - 483 (2007/10/02)
The synthesis and characteristics of a series of 2-ethers of 1-amino-4-(arylamino)anthraquinone by various preparative routes are described. Replacement of a bromine atom in the beta -position by a phenoxy group increased the molecular size.