129050-62-0 Usage
General Description
BETA-ALANINE-N,N-DIACETICACIDTRISODIUMSALT is a molecular compound commonly used as a chelating agent and sequestrant in various industrial and commercial applications. This chemical is comprised of three sodium ions bonded to a molecule of beta-alanine-N,N-diacetic acid, which is derived from the amino acid beta-alanine. BETA-ALANINE-N,N-DIACETICACIDTRISODIUMSALT is known for its ability to bind and remove metal ions, making it useful in detergents, cleaning products, and water treatment. Additionally, it is utilized in the formulation of pharmaceuticals, personal care products, and food and beverages to enhance stability and shelf life. Due to its ability to form complexes with metals, this compound plays a crucial role in preventing metal-catalyzed degradation and enhancing the effectiveness of various products.
Check Digit Verification of cas no
The CAS Registry Mumber 129050-62-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,0,5 and 0 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 129050-62:
(8*1)+(7*2)+(6*9)+(5*0)+(4*5)+(3*0)+(2*6)+(1*2)=110
110 % 10 = 0
So 129050-62-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO6.3Na/c9-5(10)1-2-8(3-6(11)12)4-7(13)14;;;/h1-4H2,(H,9,10)(H,11,12)(H,13,14);;;/q;3*+1/p-3