130699-47-7 Usage
Chemical class
Belongs to the class of aporphine alkaloids, which are naturally occurring organic compounds derived from plants.
Derivative
A derivative of the natural plant alkaloid noraporphine, with an allyl group attached to the nitrogen atom.
Allyl group
The presence of an allyl group (a propene-based group) attached to the nitrogen atom differentiates 11-hydroxy-N-allylnoraporphine from its parent compound, noraporphine.
Neuropharmacology
Has been studied for its potential role in neuropharmacology, which is the study of how drugs interact with the nervous system.
Medicinal chemistry
Has been investigated for its potential applications in medicinal chemistry, which involves designing and developing new drugs to treat various diseases and conditions.
Pharmacological properties
Exhibits diverse pharmacological properties, such as antioxidant, neuroprotective, and anti-inflammatory effects.
Antioxidant
Possesses antioxidant properties, which help protect cells from damage caused by reactive oxygen species (ROS).
Neuroprotective
Demonstrates neuroprotective effects, which can help prevent or reduce damage to neurons and support their survival.
Anti-inflammatory
Exhibits anti-inflammatory properties, which can help reduce inflammation in the body and potentially alleviate symptoms of various conditions.
Therapeutic potential
Research suggests that 11-hydroxy-N-allylnoraporphine may have therapeutic potential for the treatment of neurodegenerative disorders and other neurological conditions.
Neurodegenerative disorders
Potentially useful in treating conditions such as Alzheimer's disease, Parkinson's disease, and multiple sclerosis, which involve the progressive loss of neuronal structure and function.
Unique structure
Its unique chemical structure and biological activities make 11-hydroxy-N-allylnoraporphine an interesting target for further investigation and potential drug development.
Drug development
The compound's properties and potential applications in treating neurological conditions make it a promising candidate for the development of new drugs to address unmet medical needs.
Check Digit Verification of cas no
The CAS Registry Mumber 130699-47-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,6,9 and 9 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 130699-47:
(8*1)+(7*3)+(6*0)+(5*6)+(4*9)+(3*9)+(2*4)+(1*7)=137
137 % 10 = 7
So 130699-47-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO.BrH/c1-2-10-20-11-9-13-5-3-7-15-18(13)16(20)12-14-6-4-8-17(21)19(14)15;/h2-8,16,21H,1,9-12H2;1H/t16-;/m1./s1
130699-47-7Relevant articles and documents
R and S Enantiomers of 11-Hydroxy- and 10,11-Dihydroxy-N-allylnoraporphine: Synthesis and Affinity for Dopamine Receptors in Rat Brain Tissue
Neumeyer, John L.,Gao, Yigong,Kula, Nora S.,Baldessarini, Ross J.
, p. 24 - 28 (2007/10/02)
The R-(-)- and S-(+)-enantiomers of 11-hydroxy-N-allyl (4), and 10,11-dihydroxy-N-allyl (3) congeners of 11-hydroxy-N-n-propylnoraporphine (11-OH-NPa, 2) or N-n-propylnorapomorphine (NPA, 1) were synthesized.Binding affinity of these compounds at dopamine
