13130-81-9 Usage
General Description
4-benzyl-1-bromoisoquinolin-3-amine is a chemical compound with the molecular formula C17H14BrN2. It is a derivative of isoquinoline and contains a benzyl and bromo group. 4-benzyl-1-bromoisoquinolin-3-amine is commonly used in pharmaceutical research and drug development due to its potential biological activities. It may have applications in the treatment of various diseases and conditions, such as cancer and neurological disorders. Additionally, it has been studied for its potential as a fluorescent probe in biological imaging and diagnostic applications. However, its specific properties and uses are still under investigation, and further research is needed to fully understand its potential benefits and limitations.
Check Digit Verification of cas no
The CAS Registry Mumber 13130-81-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,1,3 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13130-81:
(7*1)+(6*3)+(5*1)+(4*3)+(3*0)+(2*8)+(1*1)=59
59 % 10 = 9
So 13130-81-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H13BrN2/c17-15-13-9-5-4-8-12(13)14(16(18)19-15)10-11-6-2-1-3-7-11/h1-9H,10H2,(H2,18,19)
