131825-41-7 Usage
General Description
3,5-Dimethylisoxazol-4-yl isocyanate is a chemical compound often used in the process of synthesizing various pharmaceuticals and bioactive molecules. 3,5-DIMETHYLISOXAZOL-4-YL ISOCYANATE, despite its complex name, belongs to the groups of Isoxazoles and Isocyanates. Isoxazoles are noted for their potential in pharmacology due to their wide range of biological activity, while isocyanates are used to make numerous products like paints, foams, and plastics. This chemical's properties allow it to act as a significant intermediate in several chemical reactions. It requires careful handling due to its reactive nature and potential toxicity.
Check Digit Verification of cas no
The CAS Registry Mumber 131825-41-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,8,2 and 5 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 131825-41:
(8*1)+(7*3)+(6*1)+(5*8)+(4*2)+(3*5)+(2*4)+(1*1)=107
107 % 10 = 7
So 131825-41-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O2/c1-4-6(7-3-9)5(2)10-8-4/h1-2H3