131890-73-8 Usage
Description
1-(2-hydroxy-2-phenylethyl)-3,5-diphenylpyrazole, also known as HPEPDP, is a chemical compound belonging to the pyrazole family, characterized by a unique chemical structure featuring a five-membered ring with two nitrogen atoms and three carbon atoms. It is synthesized through a series of chemical reactions, including the condensation of 1-phenyl-2,3-dimethyl-3-pyrazolin-5-one with benzaldehyde and subsequent reduction of the resulting enaminone.
Uses
Used in Medicinal Chemistry:
1-(2-hydroxy-2-phenylethyl)-3,5-diphenylpyrazole is used as a pharmaceutical compound for its potential anti-inflammatory, analgesic, and neuroprotective properties. Its unique structure and properties make it a promising candidate for the development of new drugs in the medical field.
Used in Materials Science:
In the field of materials science, 1-(2-hydroxy-2-phenylethyl)-3,5-diphenylpyrazole is used as a component in the development of novel optical and electronic materials. Its specific characteristics contribute to the advancement of these technologies, potentially leading to improved performance and functionality in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 131890-73-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,8,9 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 131890-73:
(8*1)+(7*3)+(6*1)+(5*8)+(4*9)+(3*0)+(2*7)+(1*3)=128
128 % 10 = 8
So 131890-73-8 is a valid CAS Registry Number.
InChI:InChI=1/C23H20N2O/c26-23(20-14-8-3-9-15-20)17-25-22(19-12-6-2-7-13-19)16-21(24-25)18-10-4-1-5-11-18/h1-16,23,26H,17H2
131890-73-8Relevant articles and documents
An efficient synthesis of β-hydroxyethylpyrazoles from propylene and styrene oxide using Cs2CO3
Duprez, Virginie,Heumann, Andreas
, p. 5697 - 5701 (2007/10/03)
Bases such as caesium carbonate efficiently catalyze the regioselective ring opening of propylene and styrene oxide with various substituted pyrazoles.