132-35-4 Usage
Description
5-[2-(diethylammonio)ethyl]-3-(1-phenylpropyl)-1,2,4-oxadiazolediylium citrate is a complex organic compound with a unique structure that features an oxadiazolediylium core and a citrate group. It is characterized by the presence of a diethylammonioethyl side chain and a 1-phenylpropyl group, which contribute to its specific properties and potential applications.
Uses
Used in Pharmaceutical Industry:
5-[2-(diethylammonio)ethyl]-3-(1-phenylpropyl)-1,2,4-oxadiazolediylium citrate is used as a relaxant for smooth muscle, which can help alleviate muscle tension and spasms. Its ability to induce relaxation in smooth muscle tissues makes it a potential candidate for the treatment of various conditions associated with muscle stiffness and pain.
Used in Pain Management:
As an analgesic, 5-[2-(diethylammonio)ethyl]-3-(1-phenylpropyl)-1,2,4-oxadiazolediylium citrate can be employed to manage and reduce pain. Its pain-relieving properties can be beneficial in various medical applications, such as post-operative pain, chronic pain conditions, and other situations where pain reduction is necessary.
Used in Anti-inflammatory Applications:
5-[2-(diethylammonio)ethyl]-3-(1-phenylpropyl)-1,2,4-oxadiazolediylium citrate also exhibits anti-inflammatory properties, making it useful in reducing inflammation and associated symptoms. This can be particularly helpful in treating conditions characterized by inflammation, such as arthritis, tendonitis, and other inflammatory disorders.
Brand Name:
Toness (Angelini Francesco, Italy) is a brand name under which 5-[2-(diethylammonio)ethyl]-3-(1-phenylpropyl)-1,2,4-oxadiazolediylium citrate may be marketed, indicating its potential commercial availability and use in medical treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 132-35-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,3 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 132-35:
(5*1)+(4*3)+(3*2)+(2*3)+(1*5)=34
34 % 10 = 4
So 132-35-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H25N3O.C6H8O7/c1-4-15(14-10-8-7-9-11-14)17-18-16(21-19-17)12-13-20(5-2)6-3;7-3(8)1-6(13,5(11)12)2-4(9)10/h7-11,15H,4-6,12-13H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)