132118-52-6 Usage
General Description
7-Bromo-2-chloro-3-ethylquinoline is a chemical compound characterized by its unique structure which includes a quinoline backbone with additional bromine, chlorine and ethyl groups. It falls under the category of quinolines, which are aromatic compounds containing a ring system composed of a benzene ring fused to a pyridine ring. The presence of bromine, chlorine, and ethyl groups adds different properties and reactivity to the compound that would generally not be present with a simple quinoline. The precise properties of this compound, such as its melting and boiling points, density, and specific rotations are not universally documented likely due to the specific and specialized usage of this compound in various research and industrial applications. It is typically used in the field of organic synthesis or as a precursor to other chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 132118-52-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,1,1 and 8 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 132118-52:
(8*1)+(7*3)+(6*2)+(5*1)+(4*1)+(3*8)+(2*5)+(1*2)=86
86 % 10 = 6
So 132118-52-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H9BrClN/c1-2-7-5-8-3-4-9(12)6-10(8)14-11(7)13/h3-6H,2H2,1H3
