132461-39-3 Usage
Description
(R)-1,2-Dithiolane-3-pentanoic acid polymer with 2-hydroxypropanoic acid is a versatile chemical compound formed by the polymerization of (R)-1,2-Dithiolane-3-pentanoic acid with 2-hydroxypropanoic acid. This polymer is known for its unique properties, which include the ability to create strong and flexible materials. It is also recognized for its potential to be used in creating biodegradable and environmentally friendly products.
Uses
Used in Pharmaceutical Applications:
(R)-1,2-Dithiolane-3-pentanoic acid polymer with 2-hydroxypropanoic acid is used as a component in drug delivery systems for its potential to enhance the efficacy and bioavailability of pharmaceutical products. Its unique properties allow for the development of innovative drug delivery methods, which can improve the therapeutic outcomes of various treatments.
Used in Cosmetic Applications:
In the cosmetics industry, (R)-1,2-Dithiolane-3-pentanoic acid polymer with 2-hydroxypropanoic acid is used as an ingredient in various cosmetic products for its ability to create strong and flexible materials. This makes it a valuable component in the formulation of products such as creams, lotions, and other skincare formulations.
Used in Food Packaging Applications:
(R)-1,2-Dithiolane-3-pentanoic acid polymer with 2-hydroxypropanoic acid is also used in the food packaging industry due to its potential to create biodegradable and environmentally friendly packaging materials. This polymer can be utilized in the development of sustainable packaging solutions that reduce the environmental impact of food packaging waste.
Overall, (R)-1,2-Dithiolane-3-pentanoic acid polymer with 2-hydroxypropanoic acid holds promise for a wide range of applications across various industries, including pharmaceuticals, cosmetics, and food packaging, due to its unique properties and potential benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 132461-39-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,4,6 and 1 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 132461-39:
(8*1)+(7*3)+(6*2)+(5*4)+(4*6)+(3*1)+(2*3)+(1*9)=103
103 % 10 = 3
So 132461-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O2S2.C3H6O3/c9-8(10)4-2-1-3-7-5-6-11-12-7;1-2(4)3(5)6/h7H,1-6H2,(H,9,10);2,4H,1H3,(H,5,6)/t7-;/m1./s1
