135680-78-3 Usage
Description
(2,5-dioxopyrrolidin-1-yl)oxyformic acid, also known as N-formylpiperidine-2,5-dione, is a chemical compound with a molecular formula C6H5NO5. It is a white solid with a molecular weight of 163.1 g/mol and a melting point of around 115-118°C. The chemical structure of (2,5-dioxopyrrolidin-1-yl)oxyformic acid contains a pyrrolidin-2,5-dione core with a formyl group attached to the nitrogen atom. (2,5-dioxopyrrolidin-1-yl)oxyformic acid has various chemical and biological properties, making it useful in different applications and plays a significant role in organic chemistry.
Uses
Used in Pharmaceutical Industry:
(2,5-dioxopyrrolidin-1-yl)oxyformic acid is used as an intermediate in the synthesis of pharmaceuticals for its versatile chemical properties and reactivity. It can be used to produce various drug molecules, contributing to the development of new medications.
Used in Agrochemical Industry:
(2,5-dioxopyrrolidin-1-yl)oxyformic acid is used as an intermediate in the synthesis of agrochemicals, such as pesticides and herbicides, due to its ability to form stable and effective compounds. This contributes to the development of new agrochemical products for agricultural applications.
Used in Organic Chemistry Research:
(2,5-dioxopyrrolidin-1-yl)oxyformic acid is used as a research compound in organic chemistry to study its chemical properties and reactivity. It can be employed to investigate new reaction mechanisms and develop innovative synthetic methods.
Used in Industrial Applications:
(2,5-dioxopyrrolidin-1-yl)oxyformic acid has potential industrial applications due to its unique chemical structure and properties. It can be utilized in the development of new materials, coatings, or other industrial products that require specific chemical characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 135680-78-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,5,6,8 and 0 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 135680-78:
(8*1)+(7*3)+(6*5)+(5*6)+(4*8)+(3*0)+(2*7)+(1*8)=143
143 % 10 = 3
So 135680-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO7/c7-3(13-5(9)10)1-2-4(8)14-6(11)12/h7H,1-2H2,(H,9,10)(H,11,12)/p-1
135680-78-3Relevant articles and documents
Preparation and use of carbohydrate-based bicyclic ring structures with antimicrobial and cytostatic activity
-
, (2008/06/13)
Novel carbohydrate-based compounds with an attached ring system that have antimicrobial or cytostatic activity. The compounds are administered to humans and animals for the treatment or amelioration of bacterial, fungal, viral or protozoal infections or tumors. The compounds are of the general formula: 1
Glycosylated prodrugs, their method of preparation and their uses
-
, (2008/06/13)
Glycosylated prodrugs, a preparation method therefor, and their use with tumor-specific immunoenzymatic conjugates for the treatment of cancer, are described. These anthracycline prodrugs have formula (I). STR1