13670-39-8 Usage
Description
1-(4,5-dihydrooxazol-2-yl)acetone, also known as DHOA, is a heterocyclic chemical compound with the molecular formula C6H9NO2. It features an oxazole ring and a ketone functional group, which contribute to its unique chemical properties and potential applications across various industries.
Uses
Used in Pharmaceutical Industry:
1-(4,5-dihydrooxazol-2-yl)acetone is used as a building block for the synthesis of various pharmaceutical drugs and organic compounds. Its unique structure allows for the creation of a wide range of molecules with potential therapeutic effects.
Used in Chemical Industry:
DHOA is used as a ligand in organometallic chemistry due to its ability to form stable complexes with metal ions. This property makes it a valuable component in coordination chemistry, where it can be utilized to create new materials with specific properties.
Used in Coordination Chemistry:
1-(4,5-dihydrooxazol-2-yl)acetone is used as a ligand for forming stable complexes with metal ions, which is crucial in the development of new coordination compounds with potential applications in various fields, including catalysis and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 13670-39-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,7 and 0 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13670-39:
(7*1)+(6*3)+(5*6)+(4*7)+(3*0)+(2*3)+(1*9)=98
98 % 10 = 8
So 13670-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H9NO2/c1-5(8)4-6-7-2-3-9-6/h2-4H2,1H3
13670-39-8Relevant articles and documents
FACILE ALKYLATION OF 2-METHYL-2-OXAZOLINE: SYNTHESIS OF NOVEL 2-SUBSTITUTED-2-OXAZOLINES
Puts, Rutger D.,Sogah, Dotsevi Y.
, p. 5779 - 5782 (1994)
The synthesis, mechanism of formation and purification of new oxazolines containg binaphthyl and biphenyl moieties based on alkylation of 2-methyl-2-oxazoline with alkyl halides are described.Yields up to 87 percent have been realized, and the method is applicable to the syntheses of other 2-substituted-2-oxazolines.
