136705-64-1 Usage
Description
(-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE is a complex organic compound with a unique molecular structure. It is characterized by its phospholano groups attached to a benzene ring, which gives it distinct chemical properties and potential applications in various fields.
Uses
Used in Chemical Synthesis:
(-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE is used as a catalyst for asymmetric hydrogenations, a crucial process in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its chiral structure allows for the selective formation of desired enantiomers, which is essential for the development of biologically active compounds.
Used in Coordination Chemistry:
In the field of coordination chemistry, (-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE serves as a highly efficient privileged ligand, particularly in the development of DuPhos and BPE ligands. These ligands play a vital role in enhancing the performance of transition metal catalysts, leading to improved reaction rates and selectivities in various chemical transformations.
Used in Pharmaceutical Industry:
(-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE is used as a key intermediate in the synthesis of novel pharmaceutical compounds. Its unique structural features enable the development of new drugs with improved potency, selectivity, and reduced side effects.
Used in Material Science:
In the field of material science, (-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLANO)BENZENE can be utilized as a building block for the development of new materials with unique properties, such as advanced polymers, optoelectronic materials, and catalysts for various applications.
Reactions
Ligand used in rhodium catalyzed asymmetric hydrogenation of 2-methylenesuccinamic acid.
Cobalt-catalyzed asymmetric hydrogenation.
Check Digit Verification of cas no
The CAS Registry Mumber 136705-64-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,7,0 and 5 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 136705-64:
(8*1)+(7*3)+(6*6)+(5*7)+(4*0)+(3*5)+(2*6)+(1*4)=131
131 % 10 = 1
So 136705-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H36P2/c1-5-17-13-14-18(6-2)23(17)21-11-9-10-12-22(21)24-19(7-3)15-16-20(24)8-4/h9-12,17-20H,5-8,13-16H2,1-4H3/t17-,18-,19-,20-/m1/s1
136705-64-1Relevant articles and documents
Preparation and use of C2-symmetric bis(phospholanes): Production of α-amino acid derivatives via highly enantioselective hydrogenation reactions
Burk, Mark J.,Feaster, John E.,Nugent, William A.,Harlow, Richard L.
, p. 10125 - 10138 (2007/10/02)
A new class of chiral C2-symmetric bis(phospholane) ligands has been prepared and used in rhodium-catalyzed asymmetric hydrogenation reactions. We describe a practical, one-pot procedure which utilizes enantiomerically pure 1,4-diol cyclic sulf