136849-75-7 Usage
Description
4-(4-HYDROXYMETHYL-3-METHOXYPHENOXY)-BUTYRIC ACID is a white to pale white powder with unique chemical properties. It is an organic compound that has potential applications in various industries due to its specific characteristics.
Uses
Used in Pharmaceutical Industry:
4-(4-HYDROXYMETHYL-3-METHOXYPHENOXY)-BUTYRIC ACID is used as a key component in the preparation of peptides using the Fmoc strategy. Its acid-labile dialkoxybenzyl-type handle allows for the efficient synthesis of peptides, which are essential in the development of new drugs and therapies.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-(4-HYDROXYMETHYL-3-METHOXYPHENOXY)-BUTYRIC ACID serves as an important intermediate for the creation of various complex molecules. Its unique structure enables the formation of new compounds with potential applications in different industries, such as pharmaceuticals, agrochemicals, and materials science.
Used in Research and Development:
4-(4-HYDROXYMETHYL-3-METHOXYPHENOXY)-BUTYRIC ACID is also utilized in research and development for the exploration of its chemical properties and potential applications. Its unique structure and reactivity make it an interesting subject for scientific investigation, which could lead to the discovery of new uses and applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 136849-75-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,8,4 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 136849-75:
(8*1)+(7*3)+(6*6)+(5*8)+(4*4)+(3*9)+(2*7)+(1*5)=167
167 % 10 = 7
So 136849-75-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O5/c1-16-11-7-10(5-4-9(11)8-13)17-6-2-3-12(14)15/h4-5,7,13H,2-3,6,8H2,1H3,(H,14,15)