137504-86-0 Usage
Description
4-Chloro-3-fluorobenzeneboronic acid is an organic compound with the molecular formula C6H4ClFO2B. It is characterized by its off-white crystalline appearance and is known for its utility in various chemical reactions and synthetic processes. 4-Chloro-3-fluorobenzeneboronic acid is particularly valuable in the field of organic chemistry due to its unique structural features, which include a chlorine atom at the 4th position and a fluorine atom at the 3rd position on the benzene ring, along with a boronic acid group attached to the 2nd position.
Uses
Used in Pharmaceutical Industry:
4-Chloro-3-fluorobenzeneboronic acid is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows for the creation of a wide range of drug candidates with potential applications in treating different medical conditions. The compound's reactivity and functional groups make it a versatile building block in the development of new medications.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-Chloro-3-fluorobenzeneboronic acid is used as a key component in the preparation of various organic compounds. Its ability to participate in a range of reactions, such as the Suzuki reaction, makes it a valuable asset in the synthesis of complex molecules with specific properties and functions.
Used in Material Science:
4-Chloro-3-fluorobenzeneboronic acid is also utilized in the development of new materials with unique properties. Its incorporation into the molecular structure of these materials can lead to enhanced performance characteristics, such as improved stability, reactivity, or selectivity, depending on the desired application.
Used in Research and Development:
Due to its synthetic utility and unique structural features, 4-Chloro-3-fluorobenzeneboronic acid is often employed in research and development settings. Scientists and researchers use this compound to explore new reaction pathways, develop novel synthetic methods, and investigate the properties of newly synthesized compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 137504-86-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,5,0 and 4 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 137504-86:
(8*1)+(7*3)+(6*7)+(5*5)+(4*0)+(3*4)+(2*8)+(1*6)=130
130 % 10 = 0
So 137504-86-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BClFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H
137504-86-0Relevant articles and documents
Preparation method of 4''-alkyl-2, 4, 3'-trifluoro-terphenyl liquid crystal monomer
-
Paragraph 0012; 0013, (2020/06/30)
The invention relates to the field of liquid crystal display, in particular to a preparation method of a 4''-alkyl-2, 4, 3'-trifluoro-terphenyl liquid crystal monomer for liquid crystal display. The preparation method comprises the following steps: taking 3-fluoro-4-chlorobromobenzene as a raw material, and preparing 3-fluoro-4-chlorophenylboronic acid through Grignard reaction; carrying out Suzuki coupling reaction on the 3-fluoro-4-chlorophenylboronic acid and 2, 4'-difluorobromobenzene to obtain a key intermediate 4'-chloro-2, 4, 3'-trifluoro-biphenyl; and carrying out Suzuki coupling reaction on the intermediate and 4-alkylphenylboronic acid to a to obtain the liquid crystal monomer. The synthesis route adopts cheap raw materials, a final product is prepared through conventional reactions, the production cost is low, large-scale production is facilitated, and the preparation method has a very high application prospect.
