137687-00-4 Usage
Description
4-Methylumbelliferyl 2-Amino-2-deoxy-a-D-glucopyranoside, with the CAS number 137687-00-4, is an off-white solid compound that is primarily utilized in organic synthesis. It is a derivative of umbelliferyl, which is a coumarin-based compound, and features a modified sugar moiety. This unique structure allows it to be used in various applications across different industries.
Uses
Used in Organic Synthesis:
4-Methylumbelliferyl 2-Amino-2-deoxy-a-D-glucopyranoside is used as a synthetic building block for the creation of complex organic molecules. Its unique structure, which combines a coumarin core with a modified sugar, makes it a valuable intermediate in the synthesis of various biologically active compounds and pharmaceuticals.
Used in Research and Development:
In the field of research and development, 4-Methylumbelliferyl 2-Amino-2-deoxy-a-D-glucopyranoside serves as a valuable tool for studying the properties and interactions of related compounds. Its use in this context aids in the discovery of new chemical entities and the development of novel therapeutic agents.
Used in Pharmaceutical Industry:
4-Methylumbelliferyl 2-Amino-2-deoxy-a-D-glucopyranoside is used as a key component in the development of new drugs, particularly those targeting specific biological pathways. Its unique structure allows for the design of molecules with enhanced selectivity and potency, which can lead to more effective treatments for various diseases.
Used in Analytical Chemistry:
In analytical chemistry, 4-Methylumbelliferyl 2-Amino-2-deoxy-a-D-glucopyranoside can be employed as a reference compound or a standard for the calibration of analytical instruments. Its well-defined structure and properties make it suitable for use in the development and validation of new methods and techniques in this field.
Used in Material Science:
4-Methylumbelliferyl 2-Amino-2-deoxy-a-D-glucopyranoside may also find applications in material science, where its unique structure could be exploited to develop new materials with specific properties. These materials could have potential uses in various industries, such as electronics, coatings, or even in the development of new drug delivery systems.
Check Digit Verification of cas no
The CAS Registry Mumber 137687-00-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,6,8 and 7 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 137687-00:
(8*1)+(7*3)+(6*7)+(5*6)+(4*8)+(3*7)+(2*0)+(1*0)=154
154 % 10 = 4
So 137687-00-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H19NO7/c1-7-4-12(19)23-10-5-8(2-3-9(7)10)22-16-13(17)15(21)14(20)11(6-18)24-16/h2-5,11,13-16,18,20-21H,6,17H2,1H3/t11?,13-,14+,15?,16-/m0/s1