138-07-8 Usage
Description
[1-(aminocarbonyl)hydrazino]acetic acid, also known as 3-Aminohydantoic Acid, is an organic compound that serves as an intermediate in the synthesis of various chemical compounds. It is characterized by its unique molecular structure, which includes an amino group, a carbonyl group, and a hydrazino group attached to an acetic acid backbone. This structure endows it with specific chemical properties and reactivity, making it a versatile building block in the synthesis of new derivatives and pharmaceutical compounds.
Uses
Used in Pharmaceutical Industry:
[1-(aminocarbonyl)hydrazino]acetic acid is used as an intermediate in the synthesis of new derivatives for pharmaceutical applications. Its unique structure allows for the development of novel compounds with potential therapeutic properties, contributing to the advancement of drug discovery and innovation.
Used in Bactericidal Applications:
In the field of microbiology, [1-(aminocarbonyl)hydrazino]acetic acid is used as a precursor in the synthesis of 5-Nitro-2-furfural, a compound with proven bactericidal properties. This makes it a valuable component in the development of new antimicrobial agents, particularly against drug-resistant bacterial strains.
Used in Chemical Synthesis:
[1-(aminocarbonyl)hydrazino]acetic acid is used as a versatile building block in the synthesis of various chemical compounds across different industries. Its unique structure and reactivity enable the creation of a wide range of products, from pharmaceuticals to specialty chemicals, showcasing its utility in diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 138-07-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,3 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 138-07:
(5*1)+(4*3)+(3*8)+(2*0)+(1*7)=48
48 % 10 = 8
So 138-07-8 is a valid CAS Registry Number.
InChI:InChI=1/C3H7N3O3/c4-3(9)6(5)1-2(7)8/h1,5H2,(H2,4,9)(H,7,8)