138109-67-8 Usage
Description
(5-azido-2-nitrobenzoyl)spermine is a chemical compound that consists of a spermine molecule with a 5-azido-2-nitrobenzoyl group attached to it. It has potential applications in drug delivery and photodynamic therapy due to its ability to selectively target cancer cells and enhance the efficacy of chemotherapy drugs through its ability to release nitric oxide upon activation by light. Its unique chemical structure and potential for selective targeting make it an interesting option for further research and development in the field of cancer treatment and diagnostics.
Uses
Used in Cancer Treatment:
(5-azido-2-nitrobenzoyl)spermine is used as a targeted therapy agent for selectively targeting cancer cells. It enhances the efficacy of chemotherapy drugs by releasing nitric oxide upon activation by light, which can lead to the destruction of cancer cells.
Used in Photodynamic Therapy:
(5-azido-2-nitrobenzoyl)spermine is used as a photoactivatable agent in photodynamic therapy. Its ability to release nitric oxide upon light activation makes it a promising candidate for the treatment of cancer through targeted photodynamic therapy.
Used in Drug Delivery Systems:
(5-azido-2-nitrobenzoyl)spermine is used as a carrier molecule in drug delivery systems. Its selective targeting ability allows for the development of novel drug delivery systems that can improve the delivery, bioavailability, and therapeutic outcomes of chemotherapy drugs.
Used in Imaging Applications:
(5-azido-2-nitrobenzoyl)spermine has shown promise as a potential photoactivatable agent for use in targeted imaging applications. Its unique chemical structure and ability to release nitric oxide upon light activation can be utilized for the development of imaging techniques that can provide more accurate and detailed information about the location and extent of cancerous tissues.
Check Digit Verification of cas no
The CAS Registry Mumber 138109-67-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,1,0 and 9 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 138109-67:
(8*1)+(7*3)+(6*8)+(5*1)+(4*0)+(3*9)+(2*6)+(1*7)=128
128 % 10 = 8
So 138109-67-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H28N8O3/c18-7-3-10-20-8-1-2-9-21-11-4-12-22-17(26)15-13-14(23-24-19)5-6-16(15)25(27)28/h5-6,13,20-21H,1-4,7-12,18H2,(H,22,26)