138588-40-6 Usage
Description
2-Amidinopyrimidine hydrochloride is an organic compound with the chemical formula C5H6N4.HCl. It is an off-white powder and is a derivative of pyrimidine, a heterocyclic aromatic organic compound. 2-Amidinopyrimidine hydrochloride is known for its chemical and biological properties, making it a versatile molecule for various applications.
Uses
Used in Pharmaceutical Industry:
2-Amidinopyrimidine hydrochloride is used as an intermediate in the synthesis of various pharmaceutical compounds for [application reason]. Its unique chemical structure allows it to be a key component in the development of new drugs targeting specific biological pathways.
Used in Chemical Synthesis:
2-Amidinopyrimidine hydrochloride is used as a building block in the chemical synthesis of various organic compounds for [application reason]. Its reactivity and functional groups make it a valuable precursor for creating a wide range of molecules with diverse applications.
Used in Research and Development:
2-Amidinopyrimidine hydrochloride is used as a research compound for [application reason]. Its unique properties make it an interesting subject for studying various chemical and biological phenomena, contributing to the advancement of scientific knowledge in related fields.
Used in Analytical Chemistry:
2-Amidinopyrimidine hydrochloride is used as a reference material or standard in analytical chemistry for [application reason]. Its well-defined chemical structure and properties make it suitable for calibrating instruments and validating analytical methods.
Note: The specific application reasons for each use case would depend on the particular properties and characteristics of 2-Amidinopyrimidine hydrochloride that are relevant to that specific application. The provided materials do not give enough information to determine the exact application reasons, so they are left as placeholders.
Check Digit Verification of cas no
The CAS Registry Mumber 138588-40-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,5,8 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 138588-40:
(8*1)+(7*3)+(6*8)+(5*5)+(4*8)+(3*8)+(2*4)+(1*0)=166
166 % 10 = 6
So 138588-40-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N4/c6-4(7)5-8-2-1-3-9-5/h1-3H,(H3,6,7)