140623-89-8 Usage
Description
1-Fluoro-2,6-dichloropyridinium tetrafluoroborate is a chemical compound that serves as a fluorinating reagent in various chemical reactions. It is characterized by its ability to selectively introduce fluorine atoms into different molecules, making it a valuable tool in the synthesis of various organic compounds.
Uses
Used in Chemical Synthesis:
1-Fluoro-2,6-dichloropyridinium tetrafluoroborate is used as a fluorinating reagent for the regioselective fluorination of fluorene. This application is particularly important in the production of specific organic compounds that require the precise introduction of fluorine atoms.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-fluoro-2,6-dichloropyridinium tetrafluoroborate is used as a key intermediate in the synthesis of various medicinal compounds. Its ability to selectively fluorinate molecules makes it a valuable asset in the development of new drugs with improved properties, such as increased potency, selectivity, or reduced side effects.
Used in Material Science:
1-Fluoro-2,6-dichloropyridinium tetrafluoroborate is also utilized in the field of material science for the synthesis of novel materials with unique properties. The introduction of fluorine atoms can significantly alter the physical and chemical characteristics of these materials, leading to new applications in areas such as electronics, energy storage, and advanced coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 140623-89-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,0,6,2 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 140623-89:
(8*1)+(7*4)+(6*0)+(5*6)+(4*2)+(3*3)+(2*8)+(1*9)=108
108 % 10 = 8
So 140623-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H3Cl2FN.BF4/c6-4-2-1-3-5(7)9(4)8;2-1(3,4)5/h1-3H;/q+1;-1
