140898-91-5 Usage
Description
5-Aminolevulinic acid hexyl ester hydrochloride is a synthetic derivative of 5-aminolevulinic acid (5-ALA), a naturally occurring amino acid. It is characterized by the presence of a hexyl ester group, which enhances its lipophilic properties, allowing for better penetration and absorption in biological systems. 5-Aminolevulinic acid hexyl ester hydrochloride has garnered significant interest due to its potential applications in various fields, particularly in medicine.
Uses
Used in Diagnostic Applications:
5-Aminolevulinic acid hexyl ester hydrochloride is used as a diagnostic agent for the detection and diagnosis of bladder cancer. Its ability to accumulate in cancerous cells and fluoresce upon exposure to specific wavelengths of light aids in the identification and localization of tumors, thereby facilitating more accurate and targeted treatment strategies.
Used in Veterinary Medicine:
In the veterinary field, 5-Aminolevulinic acid hexyl ester hydrochloride is employed as a therapeutic agent for the treatment of various cancers in domestic animals. It functions by inducing programmed cell death (apoptosis) and stimulating the production of proteins that promote apoptosis, leading to the selective destruction of cancerous cells while minimizing damage to healthy tissues.
These applications highlight the versatility and potential of 5-Aminolevulinic acid hexyl ester hydrochloride in both human and veterinary medicine, showcasing its importance in the ongoing fight against cancer and the development of novel diagnostic and therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 140898-91-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,0,8,9 and 8 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 140898-91:
(8*1)+(7*4)+(6*0)+(5*8)+(4*9)+(3*8)+(2*9)+(1*1)=155
155 % 10 = 5
So 140898-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H21NO3.ClH/c1-2-3-4-5-8-15-11(14)7-6-10(13)9-12;/h2-9,12H2,1H3;1H
