141998-22-3 Usage
Description
N1,N10-Diacetyl TriethylenetetraMine, also known as a metabolite of the selective Cu(II)-chelator Triethylenetetramine (T776630), is a compound that plays a significant role in the field of chemistry and biology. It is derived from the parent compound Triethylenetetramine, which is known for its ability to selectively chelate copper ions (CuII). This characteristic makes N1,N10-Diacetyl TriethylenetetraMine a potentially valuable compound for various applications.
Uses
Used in Chemical Research:
N1,N10-Diacetyl TriethylenetetraMine is used as a research compound for studying the properties and behavior of Cu(II)-chelator metabolites. Its role in the metabolism of Triethylenetetramine (T776630) makes it an important subject for understanding the interactions between chelators and metal ions, as well as their potential applications in various fields.
Used in Pharmaceutical Development:
N1,N10-Diacetyl TriethylenetetraMine is used as a starting point for the development of new pharmaceuticals. Its unique structure and properties may provide insights into the design of novel drugs that can target specific biological processes or interact with specific receptors. Additionally, its relationship with the Cu(II)-chelator Triethylenetetramine (T776630) may offer opportunities for the development of drugs that can modulate copper ion levels in the body, which could have therapeutic benefits for certain conditions.
Used in Environmental Applications:
N1,N10-Diacetyl TriethylenetetraMine may be used as an environmental compound for the remediation of copper-contaminated sites. Its ability to chelate copper ions could make it a valuable tool for removing excess copper from soil, water, or other environmental media, thereby reducing the potential for harm to ecosystems and human health.
Used in Analytical Chemistry:
N1,N10-Diacetyl TriethylenetetraMine can be used as an analytical reagent for the detection and quantification of copper ions in various samples. Its selective chelation properties may enable the development of sensitive and specific analytical methods for determining copper concentrations in a wide range of applications, from environmental monitoring to clinical diagnostics.
Check Digit Verification of cas no
The CAS Registry Mumber 141998-22-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,9,9 and 8 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 141998-22:
(8*1)+(7*4)+(6*1)+(5*9)+(4*9)+(3*8)+(2*2)+(1*2)=153
153 % 10 = 3
So 141998-22-3 is a valid CAS Registry Number.
141998-22-3Relevant articles and documents
Regiospecific synthesis of mono- or diacetylated polyethylenepolyamine derivatives
Kuswik-Rabiega,Bruenger,Miller
, p. 1307 - 1318 (1992)
Acetylated polyethylenepolyamines CH3CONHCH2(CH2-NH-CH2)(n)CH2NH2 (n = 1,2;) were synthesized using α-D-pentaacetyl-glucose as an acetylating agent.
