14214-33-6 Usage
Structure
A triethylamine derivative with a 4-chlorophenylthio group attached to the amino nitrogen
Usage
In organic synthesis as a reagent for the formation of amides and other nitrogen-containing compounds, and as a building block for the synthesis of potential pharmaceutical agents in medicinal chemistry and drug discovery
Handling and storage
Typically handled and stored under controlled conditions due to its potential reactivity and toxicity.
Check Digit Verification of cas no
The CAS Registry Mumber 14214-33-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,2,1 and 4 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14214-33:
(7*1)+(6*4)+(5*2)+(4*1)+(3*4)+(2*3)+(1*3)=66
66 % 10 = 6
So 14214-33-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H18ClNS/c1-3-14(4-2)9-10-15-12-7-5-11(13)6-8-12/h5-8H,3-4,9-10H2,1-2H3
