143112-52-1 Usage
General Description
"(S)-(+)-4-NITRO-7-(3-AMINOPYRROLIDIN-1-YL)-2,1,3-BENZOXADIAZOLE" is a chemical compound with a complex and specific structure. It contains a nitro group, aminopyrrolidin-1-yl group, and a benzoxadiazole group, which makes it a unique and potentially useful molecule. The compound has potential applications in pharmaceuticals, materials science, and other fields due to its structural complexity and specific properties. It may have potential as a drug candidate, a fluorescent label, or a building block for organic synthesis. Further research and development may reveal the full potential of this compound in various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 143112-52-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,3,1,1 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 143112-52:
(8*1)+(7*4)+(6*3)+(5*1)+(4*1)+(3*2)+(2*5)+(1*2)=81
81 % 10 = 1
So 143112-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N5O3/c11-6-3-4-14(5-6)7-1-2-8(15(16)17)10-9(7)12-18-13-10/h1-2,6H,3-5,11H2/t6-/m0/s1