14504-73-5 Usage
Description
Tritoqualine is a compound that has been utilized in various biological studies, particularly focusing on the proliferation of interleukin-3 dependent cell lines and the inhibition of sensitive cells. It plays a significant role in understanding cellular processes and has potential applications in the field of medicine.
Uses
Used in Pharmaceutical Industry:
Tritoqualine is used as a research compound for studying the proliferation of interleukin-3 dependent cell lines. This application aids in understanding the underlying mechanisms of cell growth and differentiation, which can be crucial for developing targeted therapies for various diseases.
Tritoqualine is also used as an inhibitor for sensitive cells, which can be beneficial in controlling cell proliferation in certain pathological conditions. This application can contribute to the development of novel treatments for conditions characterized by uncontrolled cell growth, such as cancer.
Used in Biotechnology Industry:
In the biotechnology sector, Tritoqualine is employed as a tool for studying cellular processes and identifying potential therapeutic targets. Its use in inhibiting sensitive cells can provide valuable insights into the regulation of cell growth and help in the development of new biotechnological applications.
Overall, Tritoqualine serves as an essential compound in both the pharmaceutical and biotechnology industries, contributing to the advancement of medical research and the development of novel therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 14504-73-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,0 and 4 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14504-73:
(7*1)+(6*4)+(5*5)+(4*0)+(3*4)+(2*7)+(1*3)=85
85 % 10 = 5
So 14504-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C26H32N2O8/c1-6-31-23-17-16(18(27)24(32-7-2)25(23)33-8-3)26(29)36-21(17)19-15-13(9-10-28(19)4)11-14-20(22(15)30-5)35-12-34-14/h11,19,21H,6-10,12,27H2,1-5H3