145122-55-0 Usage
General Description
6,9-DIAZA-SPIRO[4.5]DECANE DIHYDROCHLORIDE is a chemical compound with the molecular formula C8H18Cl2N2. It is a dihydrochloride salt of a spirocyclic amine, which means it contains two chloride ions. 6,9-DIAZA-SPIRO[4.5]DECANE DIHYDROCHLORIDE is often used in organic chemistry as a building block for the synthesis of various heterocyclic compounds. It is also known for its use as a ligand in coordination chemistry, where it can form complexes with metal ions. Additionally, 6,9-DIAZA-SPIRO[4.5]DECANE DIHYDROCHLORIDE has been researched for its potential pharmaceutical applications, particularly in the development of new drugs and medicinal compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 145122-55-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,1,2 and 2 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 145122-55:
(8*1)+(7*4)+(6*5)+(5*1)+(4*2)+(3*2)+(2*5)+(1*5)=100
100 % 10 = 0
So 145122-55-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2.2ClH/c1-2-4-8(3-1)7-9-5-6-10-8;;/h9-10H,1-7H2;2*1H
