14537-01-0 Usage
Description
3-FLUORO-3-DEOXY-D-XYLOFURANOSE, also known as 3-Deoxy-3-fluoro-D-xylose, is a chemical compound with the CAS number 14537-01-0. It is a derivative of D-xylose, a five-carbon sugar, where one of the hydroxyl groups is replaced by a fluorine atom, and the other is removed, resulting in a unique structure with potential applications in various fields.
Uses
Used in Organic Synthesis:
3-FLUORO-3-DEOXY-D-XYLOFURANOSE is used as a synthetic building block for the creation of various organic compounds. Its unique structure allows for the development of novel molecules with potential applications in pharmaceuticals, materials science, and other chemical industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-FLUORO-3-DEOXY-D-XYLOFURANOSE is used as a key intermediate in the synthesis of new drugs. Its distinct chemical properties enable the design and development of innovative therapeutic agents with improved efficacy and selectivity.
Used in Materials Science:
3-FLUORO-3-DEOXY-D-XYLOFURANOSE is also utilized in the field of materials science for the development of advanced materials with specific properties. Its incorporation into polymers and other materials can lead to enhanced performance characteristics, such as improved mechanical strength, thermal stability, or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 14537-01-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,3 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 14537-01:
(7*1)+(6*4)+(5*5)+(4*3)+(3*7)+(2*0)+(1*1)=90
90 % 10 = 0
So 14537-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H9FO4/c6-3-2(1-7)10-5(9)4(3)8/h2-5,7-9H,1H2/t2-,3+,4-,5?/m1/s1