14561-56-9 Usage
General Description
2-amino-3-chlorobutyric acid, also known as beta-Amino-3-chloropropionic acid or β-Amino-β-methyl-β-chloroethanoic acid, is a chemical compound with the molecular formula C4H8ClNO2. It is an amino acid derivative with a chlorine atom attached to the third carbon of the butyric acid backbone. 2-amino-3-chlorobutyric acid is not a naturally occurring amino acid, but rather a synthetic chemical used in research and pharmaceutical applications. It has been studied for its potential therapeutic effects on epilepsy and neurological disorders, as well as its role as a precursor in the synthesis of other bioactive molecules. The chemical properties and potential biological activities of 2-amino-3-chlorobutyric acid make it an area of interest for further scientific investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 14561-56-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,6 and 1 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 14561-56:
(7*1)+(6*4)+(5*5)+(4*6)+(3*1)+(2*5)+(1*6)=99
99 % 10 = 9
So 14561-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H8ClNO2/c1-2(5)3(6)4(7)8/h2-3H,6H2,1H3,(H,7,8)
