14573-97-8 Usage
General Description
{2-[3-(Dimethylamino)propoxy]phenyl}methanol is a chemical compound with a molecular formula C16H25NO2. It is an organic compound containing a phenyl group connected to a methanol group through a propoxy linker, which contains a dimethylamino group. {2-[3-(Dimethylamino)propoxy]phenyl}methanol is commonly used as a building block in organic synthesis and drug discovery. It is also known for its potential pharmacological properties and is being studied for its potential use in the development of new medications. Additionally, {2-[3-(Dimethylamino)propoxy]phenyl}methanol is used in the manufacturing of various products such as pharmaceuticals, agrochemicals, and specialty chemicals. Overall, this compound has diverse applications and is of interest in various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 14573-97-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,7 and 3 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 14573-97:
(7*1)+(6*4)+(5*5)+(4*7)+(3*3)+(2*9)+(1*7)=118
118 % 10 = 8
So 14573-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H19NO2/c1-13(2)8-5-9-15-12-7-4-3-6-11(12)10-14/h3-4,6-7,14H,5,8-10H2,1-2H3