146697-87-2 Usage
General Description
1-Ethoxymethyl-2-iodoimidazole is a chemical compound with the molecular formula C7H9IN2O. It is a derivative of imidazole and contains an ethoxymethyl group and an iodine atom attached to the imidazole ring. 1-Ethoxymethyl-2-iodoimidazole is used as a reagent in organic synthesis and pharmaceutical research. It is also known for its potential use as an antifungal agent and has been studied for its biological activity. Additionally, 1-Ethoxymethyl-2-iodoimidazole has been used in the development of new drugs and as a building block for the synthesis of other biologically active compounds. Overall, this chemical has various potential applications in the fields of chemistry and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 146697-87-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,6,6,9 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 146697-87:
(8*1)+(7*4)+(6*6)+(5*6)+(4*9)+(3*7)+(2*8)+(1*7)=182
182 % 10 = 2
So 146697-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H9IN2O/c1-2-10-5-9-4-3-8-6(9)7/h3-4H,2,5H2,1H3