14685-79-1 Usage
Description
2-CHLORO-2-DEOXY-D-GLUCOSE, also known as 2-Deoxy-2-chloro-D-glucose, is a derivative of D-Glucose (G595000) characterized by the replacement of a hydroxyl group with a chlorine atom at the second carbon position. It is a nearly colorless solid with hygroscopic properties, which means it has the ability to absorb moisture from the surrounding environment.
Uses
Used in Pharmaceutical Industry:
2-CHLORO-2-DEOXY-D-GLUCOSE is used as an intermediate in the synthesis of sugar nucleotides and oligosaccharides for various pharmaceutical applications. These synthesized compounds play a crucial role in the development of drugs targeting various diseases, including cancer and other conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2-CHLORO-2-DEOXY-D-GLUCOSE serves as a key building block for creating a wide range of complex carbohydrate structures. These structures are essential in various research and development activities, particularly in the study of carbohydrate-based interactions and their role in biological processes.
Used in Research and Development:
2-CHLORO-2-DEOXY-D-GLUCOSE is also utilized in research and development for its unique chemical properties. It can be employed in the study of carbohydrate metabolism, enzyme inhibition, and the development of novel therapeutic agents targeting specific biological pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 14685-79-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,6,8 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 14685-79:
(7*1)+(6*4)+(5*6)+(4*8)+(3*5)+(2*7)+(1*9)=131
131 % 10 = 1
So 14685-79-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H11ClO5/c7-3(1-8)5(11)6(12)4(10)2-9/h1,3-6,9-12H,2H2/t3-,4+,5+,6+/m0/s1
