146948-44-9 Usage
Description
4-AMINO-2-METHYL-5-NITRO-BENZOIC ACID METHYL ESTER, also known as Methyl 3-amino-2-methyl-5-nitrobenzoate, is an organic compound that serves as a crucial intermediate in the synthesis of various pharmaceutical compounds. It is characterized by its amino, methyl, and nitro functional groups, which contribute to its reactivity and potential applications in the chemical and pharmaceutical industries.
Uses
Used in Pharmaceutical Synthesis:
4-AMINO-2-METHYL-5-NITRO-BENZOIC ACID METHYL ESTER is used as an intermediate in the synthesis of 3-Amino-5-nitro-o-toluamide (A105200), which is a metabolite of the veterinary drug zoalene. This application is significant because it contributes to the development of veterinary medications that can be used to treat various health conditions in animals.
In the pharmaceutical industry, 4-AMINO-2-METHYL-5-NITRO-BENZOIC ACID METHYL ESTER plays a vital role in the synthesis of compounds that can be further developed into potential drugs for human or animal use. Its unique chemical structure allows for various chemical reactions, making it a valuable building block in the creation of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 146948-44-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,6,9,4 and 8 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 146948-44:
(8*1)+(7*4)+(6*6)+(5*9)+(4*4)+(3*8)+(2*4)+(1*4)=169
169 % 10 = 9
So 146948-44-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O4/c1-5-3-7(10)8(11(13)14)4-6(5)9(12)15-2/h3-4H,10H2,1-2H3
146948-44-9Relevant articles and documents
Nucleophilic substitution of the acetoxy group in 3- methylbenzoylaminomethyl acetate
Labanauskas,Mazeikaite,Striela,Gedrimaite,Urbelis,Zilinskas
experimental part, p. 1672 - 1676 (2012/09/05)
Replacement of the acetoxy group in 3-methylbenzoylaminomethyl acetate with N- and S-nucleophiles generated from amines and thio compounds using sodium hydride gives the corresponding N-aminomethyl- and N-thiomethylbenzamides.
