147143-58-6 Usage
General Description
2-(4-Fluorophenoxy)-3-nitropyridine is a chemical compound with the molecular formula C11H7FN2O3. It is a nitro pyridine derivative with a fluorophenoxy group attached to the second position. 2-(4-FLUOROPHENOXY)-3-NITROPYRIDINE is mainly used in the field of pharmaceutical research and development as an intermediate in the synthesis of various pharmaceutical drugs. The fluorine atom in the molecule imparts unique chemical and physical properties, making it useful in medicinal chemistry. Additionally, the nitro group can undergo various chemical reactions, allowing for the synthesis of diverse compounds for potential drug candidates. However, this compound should be handled and used with caution, as it may pose health and environmental risks.
Check Digit Verification of cas no
The CAS Registry Mumber 147143-58-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,1,4 and 3 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 147143-58:
(8*1)+(7*4)+(6*7)+(5*1)+(4*4)+(3*3)+(2*5)+(1*8)=126
126 % 10 = 6
So 147143-58-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H7FN2O3/c12-8-3-5-9(6-4-8)17-11-10(14(15)16)2-1-7-13-11/h1-7H
147143-58-6Relevant articles and documents
PYRROLO[2,3-c]PYRIDINE DERIVATIVES AND PROCESSES FOR THE PREPARATION THEREOF
-
Page/Page column 82, (2010/10/20)
The present invention provides novel pyrrolo[2,3-c]pyridine derivatives or pharmaceutically acceptable salts thereof, processes for the preparation thereof, and compositions comprising the same. The pyrrolo[2,3-c]pyridine derivatives or pharmaceutically acceptable salts thereof of the present invention have excellent proton pump inhibition effects and possess the ability to attain a reversible proton pump inhibitory effect.