149609-86-9 Usage
General Description
4-[(4-Chlorophenyl)thio]thiophene-3-carboxylic acid is a chemical compound with a molecular formula C14H9ClO2S2. It belongs to the class of thiophenes, which are heterocyclic compounds containing a five-membered ring of four carbon atoms and one sulfur atom. The compound contains a carboxylic acid group and a thioether group, as well as a chlorine-substituted phenyl ring. 4-[(4-CHLOROPHENYL)THIO]THIOPHENE-3-CARBOXYLIC ACID has potential applications in pharmaceuticals, agrochemicals, and materials science due to its unique chemical properties. Studies have shown that it possesses anti-inflammatory and antimicrobial activity, making it a potential candidate for the development of new drugs. Furthermore, its heterocyclic structure makes it a valuable building block for the synthesis of diverse organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 149609-86-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,6,0 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 149609-86:
(8*1)+(7*4)+(6*9)+(5*6)+(4*0)+(3*9)+(2*8)+(1*6)=169
169 % 10 = 9
So 149609-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H7ClO2S2/c12-7-1-3-8(4-2-7)16-10-6-15-5-9(10)11(13)14/h1-6H,(H,13,14)
