15165-79-4 Usage
Description
1-Naphthaleneacetic Acid Potassium Salt, also known as α-Naphthaleneacetic Acid Potassium Salt, is a synthetic plant growth regulator derived from the naphthalene family of organic compounds. It possesses properties that enable it to influence various aspects of plant growth and development, making it a valuable tool in the agricultural and horticultural industries.
Uses
Used in Agriculture and Horticulture:
1-Naphthaleneacetic Acid Potassium Salt is used as a synthetic growth factor for promoting conidial germination, sporulation, mycelial growth, and altering cell surface morphology in plants. It is particularly effective in enhancing the viability of certain fungal plant pathogens, which can be beneficial for controlling plant diseases and improving crop yields.
Additionally, due to its growth-regulating properties, 1-Naphthaleneacetic Acid Potassium Salt can be employed in various applications within the agriculture and horticulture industries, such as:
1. Stimulating root growth in cuttings and seedlings, which can lead to faster establishment and improved plant health.
2. Encouraging fruit development and ripening, which can result in higher fruit yields and better quality produce.
3. Controlling the growth of certain plant species, such as weeds, by manipulating their growth patterns and development.
Check Digit Verification of cas no
The CAS Registry Mumber 15165-79-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,1,6 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 15165-79:
(7*1)+(6*5)+(5*1)+(4*6)+(3*5)+(2*7)+(1*9)=104
104 % 10 = 4
So 15165-79-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H10O2.K/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H,13,14);/q;+1/p-1
