15251-47-5 Usage
Description
2-(3-PYRIDINYL)PIPERIDINE HYDROCHLORIDE is an organic compound with the chemical structure that features a piperidine ring fused to a pyridine ring. It is a derivative of piperidine, a heterocyclic amine that is commonly found in various pharmaceutical compounds. This particular compound is characterized by its hydrochloride salt form, which may enhance its solubility and stability in certain applications.
Uses
Used in Pharmaceutical Industry:
2-(3-PYRIDINYL)PIPERIDINE HYDROCHLORIDE is used as an active pharmaceutical ingredient for its potential therapeutic effects. Its chemical structure suggests that it may interact with various biological targets, such as receptors or enzymes, which could make it a candidate for the development of new drugs targeting specific medical conditions.
Used in Chemical Research:
In the field of chemical research, 2-(3-PYRIDINYL)PIPERIDINE HYDROCHLORIDE can be used as a starting material or intermediate for the synthesis of more complex molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Analytical Chemistry:
2-(3-PYRIDINYL)PIPERIDINE HYDROCHLORIDE may also find use in analytical chemistry as a reference material or standard for the development and validation of analytical methods, such as high-performance liquid chromatography (HPLC) or mass spectrometry (MS), which are commonly employed for the identification and quantification of compounds in complex samples.
Check Digit Verification of cas no
The CAS Registry Mumber 15251-47-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,2,5 and 1 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 15251-47:
(7*1)+(6*5)+(5*2)+(4*5)+(3*1)+(2*4)+(1*7)=85
85 % 10 = 5
So 15251-47-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2.ClH/c1-2-7-12-10(5-1)9-4-3-6-11-8-9;/h3-4,6,8,10,12H,1-2,5,7H2;1H
