15590-90-6 Usage
Description
4-Hydroxy-3-nitropyridine, also known as 3-Nitro-4-pyridone (CAS# 15590-90-6), is a light yellow solid compound with significant utility in the field of organic synthesis. It is characterized by its unique chemical structure, which features a nitro group at the 3rd position and a hydroxyl group at the 4th position on a pyridine ring. This structure endows it with versatile reactivity and makes it a valuable building block for the development of various complex organic molecules.
Uses
Used in Organic Synthesis:
4-Hydroxy-3-nitropyridine is used as a synthetic building block for the creation of a wide range of complex organic molecules. Its unique structure allows for various chemical reactions, such as substitution, addition, and condensation, which can be harnessed to synthesize a diverse array of compounds with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Hydroxy-3-nitropyridine is used as a key intermediate in the synthesis of various drug candidates. Its reactivity and structural diversity make it a valuable component in the development of new therapeutic agents, particularly those targeting specific biological pathways or receptors.
Used in Agrochemical Industry:
4-Hydroxy-3-nitropyridine is also utilized in the agrochemical industry for the synthesis of novel pesticides and other crop protection agents. Its unique chemical properties enable the development of innovative compounds with enhanced efficacy and selectivity, contributing to more effective and environmentally friendly agricultural practices.
Used in Dye and Pigment Industry:
In the dye and pigment industry, 4-Hydroxy-3-nitropyridine is employed as a starting material for the synthesis of various organic dyes and pigments. Its light yellow solid form and chemical reactivity contribute to the development of new colorants with improved properties, such as enhanced color strength, stability, and resistance to fading.
Check Digit Verification of cas no
The CAS Registry Mumber 15590-90-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,5,9 and 0 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 15590-90:
(7*1)+(6*5)+(5*5)+(4*9)+(3*0)+(2*9)+(1*0)=116
116 % 10 = 6
So 15590-90-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H20INO3/c1-3-20-18(21)14-10-15(19)17(16(11-14)22-4-2)23-12-13-8-6-5-7-9-13/h5-11H,3-4,12H2,1-2H3,(H,20,21)
15590-90-6Relevant articles and documents
Synthesis and reactivity of highly nucleophilic pyridines
De Rycke, Nicolas,Berionni, Guillaume,Couty, Francois,Mayr, Herbert,Goumont, Regis,David, Olivier R. P.
supporting information; experimental part, p. 530 - 533 (2011/03/23)
3,4,5-Triamino-substituted pyridines are avid for electrophiles but are still willing to give them back. In these compounds three amino groups conjoin their forces into the heterocyclic nitrogen, making it a powerful Lewis base. A short and efficient synt
Anti-inflammatory oxazole[4,5-b]pyridines
-
, (2008/06/13)
The various isomers of oxazolo- and thiazolopyridines having utility as antiinflammatory, antipyretic and analgesic agents are prepared by condensation of an appropriate amino-hydroxypyridine or amino-mercaptopyridine with a carboxylic acid, halide or anhydride.
