15656-28-7 Usage
Description
Bis(pyridine)iodonium tetrafluoroborate, also known as iodonium tetrafluoroborate, is a chemical compound with the formula (C5H5N)2I+BF4-. It is a yellow powder that serves as a mild iodinating and oxidizing reagent in various chemical reactions. Its unique properties make it a versatile compound for different applications across various industries.
Uses
1. Used in Chemical Synthesis:
Bis(pyridine)iodonium tetrafluoroborate is used as a mild iodinating and oxidizing reagent for chemical synthesis. Its ability to selectively iodinate free phenolic groups in tyrosine residues during solid-phase synthesis makes it a valuable tool in the development of new compounds and materials.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, Bis(pyridine)iodonium tetrafluoroborate is used as a reagent for the synthesis of various drugs and drug candidates. Its selective iodination properties can be exploited to create novel drug molecules with improved pharmacological properties.
3. Used in Material Science:
In material science, Bis(pyridine)iodonium tetrafluoroborate can be used to develop new materials with specific properties. Its ability to act as a mild oxidizing agent can be utilized in the synthesis of advanced materials with tailored characteristics.
4. Used in Analytical Chemistry:
Bis(pyridine)iodonium tetrafluoroborate is also used in analytical chemistry as a reagent for the detection and quantification of specific compounds. Its selective iodination properties can be employed in the development of new analytical methods and techniques.
5. Used in Environmental Applications:
In environmental applications, Bis(pyridine)iodonium tetrafluoroborate can be used for the treatment of contaminated water and soil. Its oxidizing properties can help in the degradation of pollutants and the removal of harmful substances from the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 15656-28-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,6,5 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 15656-28:
(7*1)+(6*5)+(5*6)+(4*5)+(3*6)+(2*2)+(1*8)=117
117 % 10 = 7
So 15656-28-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H10IN2/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-10H/q+1
