158747-10-5 Usage
Description
4-(METHYLAMINO)CYCLOHEXANONE 2 2-DIMETH&, also known as N,3,3-trimethyl-1,5-dioxaspiro[5.5]undecan-9-amine hydrochloride (1:1), is a chemical compound with a complex structure. It is characterized by its unique molecular arrangement and properties, which make it suitable for various applications across different industries.
Uses
Used in Pharmaceutical Industry:
4-(METHYLAMINO)CYCLOHEXANONE 2 2-DIMETH& is used as an intermediate compound for the synthesis of various pharmaceutical products. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific medical conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-(METHYLAMINO)CYCLOHEXANONE 2 2-DIMETH& serves as a valuable building block for creating more complex molecules. Its versatile structure enables it to be used in the production of a wide range of chemical products, including specialty chemicals and advanced materials.
Used in Research and Development:
Due to its unique properties, 4-(METHYLAMINO)CYCLOHEXANONE 2 2-DIMETH& is also utilized in research and development settings. Scientists and researchers use this compound to study its interactions with other molecules and to explore its potential applications in various fields, such as materials science, drug discovery, and chemical engineering.
Used in Analytical Chemistry:
4-(METHYLAMINO)CYCLOHEXANONE 2 2-DIMETH& can be employed as a reference material or standard in analytical chemistry. Its well-defined structure and properties make it suitable for use in calibration and validation processes, ensuring the accuracy and reliability of analytical measurements.
Check Digit Verification of cas no
The CAS Registry Mumber 158747-10-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,8,7,4 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 158747-10:
(8*1)+(7*5)+(6*8)+(5*7)+(4*4)+(3*7)+(2*1)+(1*0)=165
165 % 10 = 5
So 158747-10-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H23NO2.ClH/c1-11(2)8-14-12(15-9-11)6-4-10(13-3)5-7-12;/h10,13H,4-9H2,1-3H3;1H
