1598-64-7 Usage
General Description
Uracil, 6-(fluoromethyl)- (6CI,8CI) is a chemical compound that belongs to the uracil family, which is a heterocyclic organic compound. It is a derivative of uracil, with a fluoromethyl group attached at the 6th position. Uracil, 6-(fluoromethyl)- (6CI,8CI) has potential applications in medicinal chemistry and drug development, as it may exhibit specific biological activities and pharmacological properties. Further research and studies are needed to fully understand the potential uses and implications of Uracil, 6-(fluoromethyl)- (6CI,8CI) in various fields such as pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 1598-64-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,9 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1598-64:
(6*1)+(5*5)+(4*9)+(3*8)+(2*6)+(1*4)=107
107 % 10 = 7
So 1598-64-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5FN2O2/c6-2-3-1-4(9)8-5(10)7-3/h1H,2H2,(H2,7,8,9,10)